C14H5F25O — CID 91447807
1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecane (PubChem CID 91447807) has the molecular formula C14H5F25O and a molecular weight of 664.14 g/mol. Its IUPAC name is 1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecane.
| Compound Name | 1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecane |
|---|---|
| PubChem CID | 91447807 |
| Molecular Formula | C14H5F25O |
| Molecular Weight | 664.14 g/mol |
| Exact Mass | 663.99 |
| IUPAC Name | 1-ethoxy-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecane |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H5F25O/c1-2-40-14(38,39)12(33,34)10(29,30)8(25,26)6(21,22)4(17,18)3(15,16)5(19,20)7(23,24)9(27,28)11(31,32)13(35,36)37/h2H2,1H3 |
| InChIKey | SIIGPMAJYMJWIP-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.14 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|