C8H5F13O3P+ — CID 122507209
ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium (PubChem CID 122507209) has the molecular formula C8H5F13O3P+ and a molecular weight of 427.07 g/mol. Its IUPAC name is ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium.
| Compound Name | ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium |
|---|---|
| PubChem CID | 122507209 |
| Molecular Formula | C8H5F13O3P+ |
| Molecular Weight | 427.07 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium |
| SMILES | CCO[P+](=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F13O3P/c1-2-23-25(22)24-8(20,21)6(15,16)4(11,12)3(9,10)5(13,14)7(17,18)19/h2H2,1H3/q+1 |
| InChIKey | ICIRYALUVHMBFA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.07 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|