C8H6F13NaO3P+ — CID 175432761
sodium;ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium;hydride (PubChem CID 175432761) has the molecular formula C8H6F13NaO3P+ and a molecular weight of 451.07 g/mol. Its IUPAC name is sodium;ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium;hydride.
| Compound Name | sodium;ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium;hydride |
|---|---|
| PubChem CID | 175432761 |
| Molecular Formula | C8H6F13NaO3P+ |
| Molecular Weight | 451.07 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | sodium;ethoxy-oxo-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)phosphanium;hydride |
| SMILES | CCO[P+](=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C8H5F13O3P.Na.H/c1-2-23-25(22)24-8(20,21)6(15,16)4(11,12)3(9,10)5(13,14)7(17,18)19;;/h2H2,1H3;;/q2*+1;-1 |
| InChIKey | LVOAUXGKTXPCAK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.07 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|