C8H13F5O — CID 175046926
1,1,2,2,3-pentafluoro-3-methyl-1-propoxybutane (PubChem CID 175046926) has the molecular formula C8H13F5O and a molecular weight of 220.18 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoro-3-methyl-1-propoxybutane.
| Compound Name | 1,1,2,2,3-pentafluoro-3-methyl-1-propoxybutane |
|---|---|
| PubChem CID | 175046926 |
| Molecular Formula | C8H13F5O |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1,1,2,2,3-pentafluoro-3-methyl-1-propoxybutane |
| SMILES | CCCOC(F)(F)C(F)(F)C(C)(C)F |
| InChI | InChI=1S/C8H13F5O/c1-4-5-14-8(12,13)7(10,11)6(2,3)9/h4-5H2,1-3H3 |
| InChIKey | PQICGSUWQFUHGZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|