C7H11ClF6OSi — CID 173043231
chloro-(1,1,2,2,3,3-hexafluoro-3-propoxypropyl)-methylsilane (PubChem CID 173043231) has the molecular formula C7H11ClF6OSi and a molecular weight of 288.69 g/mol. Its IUPAC name is chloro-(1,1,2,2,3,3-hexafluoro-3-propoxypropyl)-methylsilane.
| Compound Name | chloro-(1,1,2,2,3,3-hexafluoro-3-propoxypropyl)-methylsilane |
|---|---|
| PubChem CID | 173043231 |
| Molecular Formula | C7H11ClF6OSi |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | chloro-(1,1,2,2,3,3-hexafluoro-3-propoxypropyl)-methylsilane |
| SMILES | CCCOC(F)(F)C(F)(F)C(F)(F)[SiH](C)Cl |
| InChI | InChI=1S/C7H11ClF6OSi/c1-3-4-15-6(11,12)5(9,10)7(13,14)16(2)8/h16H,3-4H2,1-2H3 |
| InChIKey | SIMJXRJXMBEAKG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|