C6H11ClF4OSi — CID 173043236
chloro-(3-ethoxy-1,1,3,3-tetrafluoropropyl)-methylsilane (PubChem CID 173043236) has the molecular formula C6H11ClF4OSi and a molecular weight of 238.68 g/mol. Its IUPAC name is chloro-(3-ethoxy-1,1,3,3-tetrafluoropropyl)-methylsilane.
| Compound Name | chloro-(3-ethoxy-1,1,3,3-tetrafluoropropyl)-methylsilane |
|---|---|
| PubChem CID | 173043236 |
| Molecular Formula | C6H11ClF4OSi |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | chloro-(3-ethoxy-1,1,3,3-tetrafluoropropyl)-methylsilane |
| SMILES | CCOC(F)(F)CC(F)(F)[SiH](C)Cl |
| InChI | InChI=1S/C6H11ClF4OSi/c1-3-12-5(8,9)4-6(10,11)13(2)7/h13H,3-4H2,1-2H3 |
| InChIKey | KGWUGQPBTHWTDL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|