C5H7F6NO — CID 165349343
2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-amine (PubChem CID 165349343) has the molecular formula C5H7F6NO and a molecular weight of 211.10 g/mol. Its IUPAC name is 2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-amine.
| Compound Name | 2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-amine |
|---|---|
| PubChem CID | 165349343 |
| Molecular Formula | C5H7F6NO |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-amine |
| SMILES | CCOC(N)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H7F6NO/c1-2-13-3(12,4(6,7)8)5(9,10)11/h2,12H2,1H3 |
| InChIKey | FXHKRJNSYDLNHL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|