C9H11F9O — CID 19761961
3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane (PubChem CID 19761961) has the molecular formula C9H11F9O and a molecular weight of 306.17 g/mol. Its IUPAC name is 3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane.
| Compound Name | 3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane |
|---|---|
| PubChem CID | 19761961 |
| Molecular Formula | C9H11F9O |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-ethoxy-1,1,1,2,3,4,5,5,5-nonafluoro-2,4-dimethylpentane |
| SMILES | CCOC(F)(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F9O/c1-4-19-7(12,5(2,10)8(13,14)15)6(3,11)9(16,17)18/h4H2,1-3H3 |
| InChIKey | VFNDRVBOLYXQJJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |