C9H5F15O2 — CID 101378869
1-ethoxy-1,2,2,3,3,4,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane (PubChem CID 101378869) has the molecular formula C9H5F15O2 and a molecular weight of 430.11 g/mol. Its IUPAC name is 1-ethoxy-1,2,2,3,3,4,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane.
| Compound Name | 1-ethoxy-1,2,2,3,3,4,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane |
|---|---|
| PubChem CID | 101378869 |
| Molecular Formula | C9H5F15O2 |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 1-ethoxy-1,2,2,3,3,4,4,4-octafluoro-1-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)butane |
| SMILES | CCOC(F)(OC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F15O2/c1-2-25-9(24,4(12,13)3(10,11)6(15,16)17)26-5(14,7(18,19)20)8(21,22)23/h2H2,1H3 |
| InChIKey | UDVPQMJQRVMKSV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|