C10H6F18O2 — CID 161274146
1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane;1,1,1,2,2,3,4,4,4-nonafluoro-3-methoxybutane (PubChem CID 161274146) has the molecular formula C10H6F18O2 and a molecular weight of 500.12 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane;1,1,1,2,2,3,4,4,4-nonafluoro-3-methoxybutane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane;1,1,1,2,2,3,4,4,4-nonafluoro-3-methoxybutane |
|---|---|
| PubChem CID | 161274146 |
| Molecular Formula | C10H6F18O2 |
| Molecular Weight | 500.12 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane;1,1,1,2,2,3,4,4,4-nonafluoro-3-methoxybutane |
| SMILES | COC(F)(C(F)(F)F)C(F)(F)C(F)(F)F.COC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C5H3F9O/c1-15-3(8,5(12,13)14)2(6,7)4(9,10)11;1-15-5(13,14)3(8,9)2(6,7)4(10,11)12/h2*1H3 |
| InChIKey | VEFCXSJFXKMYJZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.12 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|