C8H3F13O — CID 150184728
1,1,2,3,3,4,5,5,6,6,7,7,7-tridecafluoro-4-methoxyhept-1-ene (PubChem CID 150184728) has the molecular formula C8H3F13O and a molecular weight of 362.09 g/mol. Its IUPAC name is 1,1,2,3,3,4,5,5,6,6,7,7,7-tridecafluoro-4-methoxyhept-1-ene.
| Compound Name | 1,1,2,3,3,4,5,5,6,6,7,7,7-tridecafluoro-4-methoxyhept-1-ene |
|---|---|
| PubChem CID | 150184728 |
| Molecular Formula | C8H3F13O |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 1,1,2,3,3,4,5,5,6,6,7,7,7-tridecafluoro-4-methoxyhept-1-ene |
| SMILES | COC(F)(C(F)(F)C(F)=C(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F13O/c1-22-7(18,4(12,13)2(9)3(10)11)5(14,15)6(16,17)8(19,20)21/h1H3 |
| InChIKey | FMEADMBMORCDNC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|