C7HF13O4S — CID 141360461
1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yloxy)ethanesulfonic acid (PubChem CID 141360461) has the molecular formula C7HF13O4S and a molecular weight of 428.12 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yloxy)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 141360461 |
| Molecular Formula | C7HF13O4S |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 427.94 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yloxy)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C7HF13O4S/c8-1(2(9)10)3(11,12)4(13,5(14,15)16)24-6(17,18)7(19,20)25(21,22)23/h(H,21,22,23) |
| InChIKey | VSJXUNVZCGPSKI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|