C7H4F10O5S — CID 165360160
2-(1-ethenoxy-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 165360160) has the molecular formula C7H4F10O5S and a molecular weight of 390.15 g/mol. Its IUPAC name is 2-(1-ethenoxy-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(1-ethenoxy-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 165360160 |
| Molecular Formula | C7H4F10O5S |
| Molecular Weight | 390.15 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 2-(1-ethenoxy-1,1,2,3,3,3-hexafluoropropan-2-yl)oxy-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | C=COC(F)(F)C(F)(OC(F)(F)C(F)(F)S(=O)(=O)O)C(F)(F)F |
| InChI | InChI=1S/C7H4F10O5S/c1-2-21-5(12,13)3(8,4(9,10)11)22-6(14,15)7(16,17)23(18,19)20/h2H,1H2,(H,18,19,20) |
| InChIKey | YNFONFXLHMOXAR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|