C4F10NO2S- — CID 162617772
1,1,1,2,2-pentafluoro-2-[1,1,2,2,2-pentafluoroethyl(sulfinato)amino]ethane (PubChem CID 162617772) has the molecular formula C4F10NO2S- and a molecular weight of 316.10 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-2-[1,1,2,2,2-pentafluoroethyl(sulfinato)amino]ethane.
| Compound Name | 1,1,1,2,2-pentafluoro-2-[1,1,2,2,2-pentafluoroethyl(sulfinato)amino]ethane |
|---|---|
| PubChem CID | 162617772 |
| Molecular Formula | C4F10NO2S- |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-2-[1,1,2,2,2-pentafluoroethyl(sulfinato)amino]ethane |
| SMILES | O=S([O-])N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF10NO2S/c5-1(6,7)3(11,12)15(18(16)17)4(13,14)2(8,9)10/h(H,16,17)/p-1 |
| InChIKey | WAYJSISJOOGJMH-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|