C8H4F13O3S- — CID 174942255
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite (PubChem CID 174942255) has the molecular formula C8H4F13O3S- and a molecular weight of 427.16 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite |
|---|---|
| PubChem CID | 174942255 |
| Molecular Formula | C8H4F13O3S- |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 426.97 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite |
| SMILES | O=S([O-])OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F13O3S/c9-3(10,1-2-24-25(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2,(H,22,23)/p-1 |
| InChIKey | GZJKPPBMHBYDPJ-UHFFFAOYSA-M |
| XLogP | 3.93 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|