C9H12F15N2O4P — CID 170848590
azane;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl dihydrogen phosphate (PubChem CID 170848590) has the molecular formula C9H12F15N2O4P and a molecular weight of 528.15 g/mol. Its IUPAC name is azane;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl dihydrogen phosphate.
| Compound Name | azane;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl dihydrogen phosphate |
|---|---|
| PubChem CID | 170848590 |
| Molecular Formula | C9H12F15N2O4P |
| Molecular Weight | 528.15 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | azane;3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluorononyl dihydrogen phosphate |
| SMILES | N.N.O=P(O)(O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F15O4P.2H3N/c10-3(11,1-2-28-29(25,26)27)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24;;/h1-2H2,(H2,25,26,27);2*1H3 |
| InChIKey | ZPWQZSLKVMQXKQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.15 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|