C8H9F13O7P2 — CID 172780459
phosphoric acid;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid (PubChem CID 172780459) has the molecular formula C8H9F13O7P2 and a molecular weight of 526.08 g/mol. Its IUPAC name is phosphoric acid;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid.
| Compound Name | phosphoric acid;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
|---|---|
| PubChem CID | 172780459 |
| Molecular Formula | C8H9F13O7P2 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.96 |
| IUPAC Name | phosphoric acid;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
| SMILES | O=P(O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=P(O)(O)O |
| InChI | InChI=1S/C8H6F13O3P.H3O4P/c9-3(10,1-2-25(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;1-5(2,3)4/h1-2H2,(H2,22,23,24);(H3,1,2,3,4) |
| InChIKey | OELHVFZXCNIDRY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|