C8H10F13NO3P+ — CID 157334633
azanium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid (PubChem CID 157334633) has the molecular formula C8H10F13NO3P+ and a molecular weight of 446.12 g/mol. Its IUPAC name is azanium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid.
| Compound Name | azanium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
|---|---|
| PubChem CID | 157334633 |
| Molecular Formula | C8H10F13NO3P+ |
| Molecular Weight | 446.12 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | azanium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
| SMILES | O=P(O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C8H6F13O3P.H3N/c9-3(10,1-2-25(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;/h1-2H2,(H2,22,23,24);1H3/p+1 |
| InChIKey | BFRRIIHSRIORBI-UHFFFAOYSA-O |
| XLogP | 4.67 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.12 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|