C14H21F13NO3P — CID 88584535
N,N-diethylethanamine;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid (PubChem CID 88584535) has the molecular formula C14H21F13NO3P and a molecular weight of 529.27 g/mol. Its IUPAC name is N,N-diethylethanamine;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid.
| Compound Name | N,N-diethylethanamine;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
|---|---|
| PubChem CID | 88584535 |
| Molecular Formula | C14H21F13NO3P |
| Molecular Weight | 529.27 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | N,N-diethylethanamine;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
| SMILES | CCN(CC)CC.O=P(O)(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F13O3P.C6H15N/c9-3(10,1-2-25(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;1-4-7(5-2)6-3/h1-2H2,(H2,22,23,24);4-6H2,1-3H3 |
| InChIKey | FXDLNDFSCHYHJA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.27 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|