C10H15F10N — CID 174739856
1,1,1,2,2,3,3,4,4,4-decafluorobutane;N,N-diethylethanamine (PubChem CID 174739856) has the molecular formula C10H15F10N and a molecular weight of 339.22 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,4-decafluorobutane;N,N-diethylethanamine.
| Compound Name | 1,1,1,2,2,3,3,4,4,4-decafluorobutane;N,N-diethylethanamine |
|---|---|
| PubChem CID | 174739856 |
| Molecular Formula | C10H15F10N |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,4-decafluorobutane;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.FC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C4F10/c1-4-7(5-2)6-3;5-1(6,3(9,10)11)2(7,8)4(12,13)14/h4-6H2,1-3H3; |
| InChIKey | WGJMJNPFCXLIEA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|