C6H27F6NO18P6 — CID 173141880
N,N-diethylethanamine;fluorophosphonic acid (PubChem CID 173141880) has the molecular formula C6H27F6NO18P6 and a molecular weight of 701.10 g/mol. Its IUPAC name is N,N-diethylethanamine;fluorophosphonic acid.
| Compound Name | N,N-diethylethanamine;fluorophosphonic acid |
|---|---|
| PubChem CID | 173141880 |
| Molecular Formula | C6H27F6NO18P6 |
| Molecular Weight | 701.10 g/mol |
| Exact Mass | 700.96 |
| IUPAC Name | N,N-diethylethanamine;fluorophosphonic acid |
| SMILES | CCN(CC)CC.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F.O=P(O)(O)F |
| InChI | InChI=1S/C6H15N.6FH2O3P/c1-4-7(5-2)6-3;6*1-5(2,3)4/h4-6H2,1-3H3;6*(H2,2,3,4) |
| InChIKey | ZIEBUUDLBQERJO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 348.42 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.10 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|