About N,N-diethylethanamine;hydroxy(oxo)phosphanium
N,N-diethylethanamine;hydroxy(oxo)phosphanium (PubChem CID 131738597) has the molecular formula C6H17NO2P+
and a molecular weight of 166.18 g/mol. Its IUPAC name is N,N-diethylethanamine;hydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | N,N-diethylethanamine;hydroxy(oxo)phosphanium |
| PubChem CID | 131738597 |
| Molecular Formula | C6H17NO2P+ |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | N,N-diethylethanamine;hydroxy(oxo)phosphanium |
| SMILES | CCN(CC)CC.O=[PH+]O |
| InChI | InChI=1S/C6H15N.HO2P/c1-4-7(5-2)6-3;1-3-2/h4-6H2,1-3H3;3H/p+1 |
| InChIKey | OPRBSWDPCUMZLM-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;hydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;hydroxy(oxo)phosphanium?
The IUPAC name of N,N-diethylethanamine;hydroxy(oxo)phosphanium (CID 131738597) is N,N-diethylethanamine;hydroxy(oxo)phosphanium.
What is the SMILES notation for N,N-diethylethanamine;hydroxy(oxo)phosphanium?
The canonical SMILES for N,N-diethylethanamine;hydroxy(oxo)phosphanium is CCN(CC)CC.O=[PH+]O.
What is the InChIKey of N,N-diethylethanamine;hydroxy(oxo)phosphanium?
The InChIKey is OPRBSWDPCUMZLM-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15N.HO2P/c1-4-7(5-2)6-3;1-3-2/h4-6H2,1-3H3;3H/p+1.
What are the key properties of N,N-diethylethanamine;hydroxy(oxo)phosphanium?
N,N-diethylethanamine;hydroxy(oxo)phosphanium has a molecular weight of 166.18 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;hydroxy(oxo)phosphanium is sourced from PubChem (CID 131738597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).