C14H32N2O4 — CID 71339505
bis(N,N-diethylethanamine);oxalic acid (PubChem CID 71339505) has the molecular formula C14H32N2O4 and a molecular weight of 292.42 g/mol. Its IUPAC name is bis(N,N-diethylethanamine);oxalic acid.
| Compound Name | bis(N,N-diethylethanamine);oxalic acid |
|---|---|
| PubChem CID | 71339505 |
| Molecular Formula | C14H32N2O4 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | bis(N,N-diethylethanamine);oxalic acid |
| SMILES | CCN(CC)CC.CCN(CC)CC.O=C(O)C(=O)O |
| InChI | InChI=1S/2C6H15N.C2H2O4/c2*1-4-7(5-2)6-3;3-1(4)2(5)6/h2*4-6H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | CNWGYUFHGPCIBU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|