C8H18F3NO3 — CID 175431120
N,N-diethylethanamine;2,2,2-trifluoroacetic acid;hydrate (PubChem CID 175431120) has the molecular formula C8H18F3NO3 and a molecular weight of 233.23 g/mol. Its IUPAC name is N,N-diethylethanamine;2,2,2-trifluoroacetic acid;hydrate.
| Compound Name | N,N-diethylethanamine;2,2,2-trifluoroacetic acid;hydrate |
|---|---|
| PubChem CID | 175431120 |
| Molecular Formula | C8H18F3NO3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N,N-diethylethanamine;2,2,2-trifluoroacetic acid;hydrate |
| SMILES | CCN(CC)CC.O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C2HF3O2.H2O/c1-4-7(5-2)6-3;3-2(4,5)1(6)7;/h4-6H2,1-3H3;(H,6,7);1H2 |
| InChIKey | SNHOYOFKGGGBDV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |