C10H27FN3OP — CID 87468287
N,N-diethylethanamine;N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine (PubChem CID 87468287) has the molecular formula C10H27FN3OP and a molecular weight of 255.32 g/mol. Its IUPAC name is N,N-diethylethanamine;N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine.
| Compound Name | N,N-diethylethanamine;N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine |
|---|---|
| PubChem CID | 87468287 |
| Molecular Formula | C10H27FN3OP |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N,N-diethylethanamine;N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine |
| SMILES | CCN(CC)CC.CN(C)P(=O)(F)N(C)C |
| InChI | InChI=1S/C6H15N.C4H12FN2OP/c1-4-7(5-2)6-3;1-6(2)9(5,8)7(3)4/h4-6H2,1-3H3;1-4H3 |
| InChIKey | JKWHIGQNYMUPRG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|