About N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine
N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine (PubChem CID 118626866) has the molecular formula C8H23FN3OP
and a molecular weight of 227.26 g/mol. Its IUPAC name is N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine.
Molecular Properties
| Compound Name | N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine |
| PubChem CID | 118626866 |
| Molecular Formula | C8H23FN3OP |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine |
| SMILES | CCNCC.CN(C)P(=O)(F)N(C)C |
| InChI | InChI=1S/C4H12FN2OP.C4H11N/c1-6(2)9(5,8)7(3)4;1-3-5-4-2/h1-4H3;5H,3-4H2,1-2H3 |
| InChIKey | GIVZWCPGISBEGB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine?
The IUPAC name of N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine (CID 118626866) is N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine.
What is the SMILES notation for N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine?
The canonical SMILES for N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine is CCNCC.CN(C)P(=O)(F)N(C)C.
What is the InChIKey of N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine?
The InChIKey is GIVZWCPGISBEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12FN2OP.C4H11N/c1-6(2)9(5,8)7(3)4;1-3-5-4-2/h1-4H3;5H,3-4H2,1-2H3.
What are the key properties of N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine?
N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine has a molecular weight of 227.26 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethylamino(fluoro)phosphoryl]-N-methylmethanamine;N-ethylethanamine is sourced from PubChem (CID 118626866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).