C15H14F19Na2O6P+2 — CID 165364131
disodium;2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecoxy)ethoxy]ethyl dihydrogen phosphate (PubChem CID 165364131) has the molecular formula C15H14F19Na2O6P+2 and a molecular weight of 728.19 g/mol. Its IUPAC name is disodium;2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecoxy)ethoxy]ethyl dihydrogen phosphate.
| Compound Name | disodium;2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecoxy)ethoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 165364131 |
| Molecular Formula | C15H14F19Na2O6P+2 |
| Molecular Weight | 728.19 g/mol |
| Exact Mass | 728.00 |
| IUPAC Name | disodium;2-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecoxy)ethoxy]ethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCOCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+].[Na+] |
| InChI | InChI=1S/C15H14F19O6P.2Na/c16-7(17,1-2-38-3-4-39-5-6-40-41(35,36)37)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)34;;/h1-6H2,(H2,35,36,37);;/q;2*+1 |
| InChIKey | ASNJXHRFANTZMC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|