C14H8F22O4P- — CID 138394217
3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate (PubChem CID 138394217) has the molecular formula C14H8F22O4P- and a molecular weight of 689.14 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate |
|---|---|
| PubChem CID | 138394217 |
| Molecular Formula | C14H8F22O4P- |
| Molecular Weight | 689.14 g/mol |
| Exact Mass | 688.98 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate |
| SMILES | O=P([O-])(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9F22O4P/c15-5(16,7(19,20)9(23,24)10(25,26)12(29,30)14(34,35)36)1-3-39-41(37,38)40-4-2-6(17,18)8(21,22)11(27,28)13(31,32)33/h1-4H2,(H,37,38)/p-1 |
| InChIKey | RTWBXVKDNXSYBW-UHFFFAOYSA-M |
| XLogP | 7.48 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.14 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|