C12H13F13O4P- — CID 102398895
butyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate (PubChem CID 102398895) has the molecular formula C12H13F13O4P- and a molecular weight of 499.18 g/mol. Its IUPAC name is butyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate.
| Compound Name | butyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate |
|---|---|
| PubChem CID | 102398895 |
| Molecular Formula | C12H13F13O4P- |
| Molecular Weight | 499.18 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | butyl 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl phosphate |
| SMILES | CCCCOP(=O)([O-])OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H14F13O4P/c1-2-3-5-28-30(26,27)29-6-4-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h2-6H2,1H3,(H,26,27)/p-1 |
| InChIKey | BMLJKHCOQFDGHD-UHFFFAOYSA-M |
| XLogP | 5.42 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.18 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|