About calcium bis(dihexyl phosphate)
calcium bis(dihexyl phosphate) (PubChem CID 159957382) has the molecular formula C24H52CaO8P2
and a molecular weight of 570.70 g/mol. Its IUPAC name is calcium bis(dihexyl phosphate).
Molecular Properties
| Compound Name | calcium bis(dihexyl phosphate) |
| PubChem CID | 159957382 |
| Molecular Formula | C24H52CaO8P2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | calcium bis(dihexyl phosphate) |
| SMILES | CCCCCCOP(=O)([O-])OCCCCCC.CCCCCCOP(=O)([O-])OCCCCCC.[Ca+2] |
| InChI | InChI=1S/2C12H27O4P.Ca/c2*1-3-5-7-9-11-15-17(13,14)16-12-10-8-6-4-2;/h2*3-12H2,1-2H3,(H,13,14);/q;;+2/p-2 |
| InChIKey | QYHCQYXQDQZMSH-UHFFFAOYSA-L |
| XLogP | 6.92 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(dihexyl phosphate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(dihexyl phosphate)?
The IUPAC name of calcium bis(dihexyl phosphate) (CID 159957382) is calcium bis(dihexyl phosphate).
What is the SMILES notation for calcium bis(dihexyl phosphate)?
The canonical SMILES for calcium bis(dihexyl phosphate) is CCCCCCOP(=O)([O-])OCCCCCC.CCCCCCOP(=O)([O-])OCCCCCC.[Ca+2].
What is the InChIKey of calcium bis(dihexyl phosphate)?
The InChIKey is QYHCQYXQDQZMSH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H27O4P.Ca/c2*1-3-5-7-9-11-15-17(13,14)16-12-10-8-6-4-2;/h2*3-12H2,1-2H3,(H,13,14);/q;;+2/p-2.
What are the key properties of calcium bis(dihexyl phosphate)?
calcium bis(dihexyl phosphate) has a molecular weight of 570.70 g/mol, XLogP of 6.92, 24 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(dihexyl phosphate) is sourced from PubChem (CID 159957382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).