About 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate
2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate (PubChem CID 102130313) has the molecular formula C22H46O8P2-2
and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate.
Molecular Properties
| Compound Name | 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate |
| PubChem CID | 102130313 |
| Molecular Formula | C22H46O8P2-2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate |
| SMILES | CCCCCCCCCCOP(=O)([O-])OCCOP(=O)([O-])OCCCCCCCCCC |
| InChI | InChI=1S/C22H48O8P2/c1-3-5-7-9-11-13-15-17-19-27-31(23,24)29-21-22-30-32(25,26)28-20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3,(H,23,24)(H,25,26)/p-2 |
| InChIKey | CGIGJMHSZRQYQD-UHFFFAOYSA-L |
| XLogP | 6.27 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate?
The IUPAC name of 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate (CID 102130313) is 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate.
What is the SMILES notation for 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate?
The canonical SMILES for 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate is CCCCCCCCCCOP(=O)([O-])OCCOP(=O)([O-])OCCCCCCCCCC.
What is the InChIKey of 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate?
The InChIKey is CGIGJMHSZRQYQD-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H48O8P2/c1-3-5-7-9-11-13-15-17-19-27-31(23,24)29-21-22-30-32(25,26)28-20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3,(H,23,24)(H,25,26)/p-2.
What are the key properties of 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate?
2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate has a molecular weight of 500.55 g/mol, XLogP of 6.27, 25 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[decoxy(oxido)phosphoryl]oxyethyl decyl phosphate is sourced from PubChem (CID 102130313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).