About zinc bis(dinonyl phosphate)
zinc bis(dinonyl phosphate) (PubChem CID 87237924) has the molecular formula C36H76O8P2Zn
and a molecular weight of 764.33 g/mol. Its IUPAC name is zinc bis(dinonyl phosphate).
Molecular Properties
| Compound Name | zinc bis(dinonyl phosphate) |
| PubChem CID | 87237924 |
| Molecular Formula | C36H76O8P2Zn |
| Molecular Weight | 764.33 g/mol |
| Exact Mass | 762.43 |
| IUPAC Name | zinc bis(dinonyl phosphate) |
| SMILES | CCCCCCCCCOP(=O)([O-])OCCCCCCCCC.CCCCCCCCCOP(=O)([O-])OCCCCCCCCC.[Zn+2] |
| InChI | InChI=1S/2C18H39O4P.Zn/c2*1-3-5-7-9-11-13-15-17-21-23(19,20)22-18-16-14-12-10-8-6-4-2;/h2*3-18H2,1-2H3,(H,19,20);/q;;+2/p-2 |
| InChIKey | USFDQSMPAIDHNA-UHFFFAOYSA-L |
| XLogP | 11.98 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 764.33 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(dinonyl phosphate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(dinonyl phosphate)?
The IUPAC name of zinc bis(dinonyl phosphate) (CID 87237924) is zinc bis(dinonyl phosphate).
What is the SMILES notation for zinc bis(dinonyl phosphate)?
The canonical SMILES for zinc bis(dinonyl phosphate) is CCCCCCCCCOP(=O)([O-])OCCCCCCCCC.CCCCCCCCCOP(=O)([O-])OCCCCCCCCC.[Zn+2].
What is the InChIKey of zinc bis(dinonyl phosphate)?
The InChIKey is USFDQSMPAIDHNA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H39O4P.Zn/c2*1-3-5-7-9-11-13-15-17-21-23(19,20)22-18-16-14-12-10-8-6-4-2;/h2*3-18H2,1-2H3,(H,19,20);/q;;+2/p-2.
What are the key properties of zinc bis(dinonyl phosphate)?
zinc bis(dinonyl phosphate) has a molecular weight of 764.33 g/mol, XLogP of 11.98, 36 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(dinonyl phosphate) is sourced from PubChem (CID 87237924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).