About bis(dioctyl phosphate);oxotitanium(2+)
bis(dioctyl phosphate);oxotitanium(2+) (PubChem CID 139722402) has the molecular formula C32H68O9P2Ti
and a molecular weight of 706.70 g/mol. Its IUPAC name is bis(dioctyl phosphate);oxotitanium(2+).
Molecular Properties
| Compound Name | bis(dioctyl phosphate);oxotitanium(2+) |
| PubChem CID | 139722402 |
| Molecular Formula | C32H68O9P2Ti |
| Molecular Weight | 706.70 g/mol |
| Exact Mass | 706.38 |
| IUPAC Name | bis(dioctyl phosphate);oxotitanium(2+) |
| SMILES | CCCCCCCCOP(=O)([O-])OCCCCCCCC.CCCCCCCCOP(=O)([O-])OCCCCCCCC.O=[Ti+2] |
| InChI | InChI=1S/2C16H35O4P.O.Ti/c2*1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2;;/h2*3-16H2,1-2H3,(H,17,18);;/q;;;+2/p-2 |
| InChIKey | ZRVVRJWPVQHLJY-UHFFFAOYSA-L |
| XLogP | 10.30 |
| TPSA | 134.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 706.70 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dioctyl phosphate);oxotitanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dioctyl phosphate);oxotitanium(2+)?
The IUPAC name of bis(dioctyl phosphate);oxotitanium(2+) (CID 139722402) is bis(dioctyl phosphate);oxotitanium(2+).
What is the SMILES notation for bis(dioctyl phosphate);oxotitanium(2+)?
The canonical SMILES for bis(dioctyl phosphate);oxotitanium(2+) is CCCCCCCCOP(=O)([O-])OCCCCCCCC.CCCCCCCCOP(=O)([O-])OCCCCCCCC.O=[Ti+2].
What is the InChIKey of bis(dioctyl phosphate);oxotitanium(2+)?
The InChIKey is ZRVVRJWPVQHLJY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H35O4P.O.Ti/c2*1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2;;/h2*3-16H2,1-2H3,(H,17,18);;/q;;;+2/p-2.
What are the key properties of bis(dioctyl phosphate);oxotitanium(2+)?
bis(dioctyl phosphate);oxotitanium(2+) has a molecular weight of 706.70 g/mol, XLogP of 10.30, 32 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dioctyl phosphate);oxotitanium(2+) is sourced from PubChem (CID 139722402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).