C8H5F13NaO3S- — CID 174850312
sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite (PubChem CID 174850312) has the molecular formula C8H5F13NaO3S- and a molecular weight of 451.16 g/mol. Its IUPAC name is sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite.
| Compound Name | sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite |
|---|---|
| PubChem CID | 174850312 |
| Molecular Formula | C8H5F13NaO3S- |
| Molecular Weight | 451.16 g/mol |
| Exact Mass | 450.97 |
| IUPAC Name | sodium;hydride;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl sulfite |
| SMILES | O=S([O-])OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C8H5F13O3S.Na.H/c9-3(10,1-2-24-25(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;;/h1-2H2,(H,22,23);;/q;+1;-1/p-1 |
| InChIKey | GLYQPKQVGSOZSP-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.16 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|