C12F26O4S2Zn — CID 135315333
zinc bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfinate) (PubChem CID 135315333) has the molecular formula C12F26O4S2Zn and a molecular weight of 831.60 g/mol. Its IUPAC name is zinc bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfinate).
| Compound Name | zinc bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfinate) |
|---|---|
| PubChem CID | 135315333 |
| Molecular Formula | C12F26O4S2Zn |
| Molecular Weight | 831.60 g/mol |
| Exact Mass | 829.81 |
| IUPAC Name | zinc bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfinate) |
| SMILES | O=S([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Zn+2] |
| InChI | InChI=1S/2C6HF13O2S.Zn/c2*7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)22(20)21;/h2*(H,20,21);/q;;+2/p-2 |
| InChIKey | FERFSNBXEOUUGP-UHFFFAOYSA-L |
| XLogP | 7.12 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.60 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|