C6HF13NO2S- — CID 175521990
1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(sulfinatoamino)hexane (PubChem CID 175521990) has the molecular formula C6HF13NO2S- and a molecular weight of 398.12 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(sulfinatoamino)hexane.
| Compound Name | 1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(sulfinatoamino)hexane |
|---|---|
| PubChem CID | 175521990 |
| Molecular Formula | C6HF13NO2S- |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 397.95 |
| IUPAC Name | 1,1,1,2,2,3,3,4,5,5,6,6,6-tridecafluoro-4-(sulfinatoamino)hexane |
| SMILES | O=S([O-])NC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F13NO2S/c7-1(8,2(9,10)5(14,15)16)4(13,20-23(21)22)3(11,12)6(17,18)19/h20H,(H,21,22)/p-1 |
| InChIKey | NNSJDZRINXBLOW-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|