C5H2F9NO — CID 123563469
N-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)formamide (PubChem CID 123563469) has the molecular formula C5H2F9NO and a molecular weight of 263.06 g/mol. Its IUPAC name is N-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)formamide.
| Compound Name | N-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)formamide |
|---|---|
| PubChem CID | 123563469 |
| Molecular Formula | C5H2F9NO |
| Molecular Weight | 263.06 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | N-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)formamide |
| SMILES | O=CNC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H2F9NO/c6-2(7,4(9,10)11)3(8,15-1-16)5(12,13)14/h1H,(H,15,16) |
| InChIKey | JTOBOIPCTLWWBT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.06 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|