C6H7F5O — CID 87372112
3,3,4,4,4-pentafluoro-2,2-dimethylbutanal (PubChem CID 87372112) has the molecular formula C6H7F5O and a molecular weight of 190.11 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-2,2-dimethylbutanal.
| Compound Name | 3,3,4,4,4-pentafluoro-2,2-dimethylbutanal |
|---|---|
| PubChem CID | 87372112 |
| Molecular Formula | C6H7F5O |
| Molecular Weight | 190.11 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-2,2-dimethylbutanal |
| SMILES | CC(C)(C=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F5O/c1-4(2,3-12)5(7,8)6(9,10)11/h3H,1-2H3 |
| InChIKey | DWUHPYNQEYEWKO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|