C11H22O — CID 59119752
2,2,3,3,4,4-hexamethylpentanal (PubChem CID 59119752) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexamethylpentanal.
| Compound Name | 2,2,3,3,4,4-hexamethylpentanal |
|---|---|
| PubChem CID | 59119752 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | 2,2,3,3,4,4-hexamethylpentanal |
| SMILES | CC(C)(C)C(C)(C)C(C)(C)C=O |
| InChI | InChI=1S/C11H22O/c1-9(2,3)11(6,7)10(4,5)8-12/h8H,1-7H3 |
| InChIKey | NWUSBXKNJSHYJJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|