C6HF11O — CID 23080700
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanal (PubChem CID 23080700) has the molecular formula C6HF11O and a molecular weight of 298.05 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanal.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanal |
|---|---|
| PubChem CID | 23080700 |
| Molecular Formula | C6HF11O |
| Molecular Weight | 298.05 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanal |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O/c7-2(8,1-18)3(9,10)4(11,12)5(13,14)6(15,16)17/h1H |
| InChIKey | OMBYOPNOROKVEG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.05 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|