C13H12F12O — CID 10927754
7-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal (PubChem CID 10927754) has the molecular formula C13H12F12O and a molecular weight of 412.21 g/mol. Its IUPAC name is 7-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal.
| Compound Name | 7-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal |
|---|---|
| PubChem CID | 10927754 |
| Molecular Formula | C13H12F12O |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 7-cyclohexyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C13H12F12O/c14-8(15,6-26)10(18,19)12(22,23)13(24,25)11(20,21)9(16,17)7-4-2-1-3-5-7/h6-7H,1-5H2 |
| InChIKey | HNGLFECMPHRQTB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|