About (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane
(2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane (PubChem CID 557964) has the molecular formula C8H11BrF4
and a molecular weight of 263.07 g/mol. Its IUPAC name is (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane.
Molecular Properties
| Compound Name | (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane |
| PubChem CID | 557964 |
| Molecular Formula | C8H11BrF4 |
| Molecular Weight | 263.07 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane |
| SMILES | FC(F)(Br)C(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C8H11BrF4/c9-8(12,13)7(10,11)6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | KNEIYQIJSHZQHH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.07 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane?
The IUPAC name of (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane (CID 557964) is (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane.
What is the SMILES notation for (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane?
The canonical SMILES for (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane is FC(F)(Br)C(F)(F)C1CCCCC1.
What is the InChIKey of (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane?
The InChIKey is KNEIYQIJSHZQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrF4/c9-8(12,13)7(10,11)6-4-2-1-3-5-6/h6H,1-5H2.
What are the key properties of (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane?
(2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane has a molecular weight of 263.07 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-1,1,2,2-tetrafluoroethyl)cyclohexane is sourced from PubChem (CID 557964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).