About CID 173025587
CID 173025587 (PubChem CID 173025587) has the molecular formula C14H25Ga
and a molecular weight of 263.08 g/mol.
Molecular Properties
| Compound Name | CID 173025587 |
| PubChem CID | 173025587 |
| Molecular Formula | C14H25Ga |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | — |
| SMILES | CC([Ga])(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H25.Ga/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h13-14H,2-11H2,1H3; |
| InChIKey | DGSYCNKVQNGIBO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173025587 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173025587?
The IUPAC name of CID 173025587 (CID 173025587) is not available.
What is the SMILES notation for CID 173025587?
The canonical SMILES for CID 173025587 is CC([Ga])(C1CCCCC1)C1CCCCC1.
What is the InChIKey of CID 173025587?
The InChIKey is DGSYCNKVQNGIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25.Ga/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h13-14H,2-11H2,1H3;.
What are the key properties of CID 173025587?
CID 173025587 has a molecular weight of 263.08 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173025587 is sourced from PubChem (CID 173025587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).