C8H10BrF4I — CID 10023205
trans-(1R,2S)-1-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-iodocyclohexane (PubChem CID 10023205) has the molecular formula C8H10BrF4I and a molecular weight of 388.97 g/mol. Its IUPAC name is trans-(1R,2S)-1-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-iodocyclohexane.
| Compound Name | trans-(1R,2S)-1-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-iodocyclohexane |
|---|---|
| PubChem CID | 10023205 |
| Molecular Formula | C8H10BrF4I |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | trans-(1R,2S)-1-(2-bromo-1,1,2,2-tetrafluoroethyl)-2-iodocyclohexane |
| SMILES | FC(F)(Br)C(F)(F)[C@H]1CCCC[C@@H]1I |
| InChI | InChI=1S/C8H10BrF4I/c9-8(12,13)7(10,11)5-3-1-2-4-6(5)14/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | KGDRVJHWSDVQEK-WDSKDSINSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|