C13H14F11I — CID 151430843
1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclooctane (PubChem CID 151430843) has the molecular formula C13H14F11I and a molecular weight of 506.14 g/mol. Its IUPAC name is 1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclooctane.
| Compound Name | 1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclooctane |
|---|---|
| PubChem CID | 151430843 |
| Molecular Formula | C13H14F11I |
| Molecular Weight | 506.14 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | 1-iodo-2-(1,1,1,2,3,3,4,4,5,5,5-undecafluoropentan-2-yl)cyclooctane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(C1CCCCCCC1I)C(F)(F)F |
| InChI | InChI=1S/C13H14F11I/c14-9(12(19,20)21,7-5-3-1-2-4-6-8(7)25)10(15,16)11(17,18)13(22,23)24/h7-8H,1-6H2 |
| InChIKey | PCMCVXHFBXRQIL-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.14 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|