C12H12F12O2 — CID 59850826
1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol (PubChem CID 59850826) has the molecular formula C12H12F12O2 and a molecular weight of 416.20 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 59850826 |
| Molecular Formula | C12H12F12O2 |
| Molecular Weight | 416.20 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol |
| SMILES | OC(C1CCCCC1C(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F12O2/c13-9(14,15)7(25,10(16,17)18)5-3-1-2-4-6(5)8(26,11(19,20)21)12(22,23)24/h5-6,25-26H,1-4H2 |
| InChIKey | OTYDEVLNQAXOSH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.20 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |