C8H10F6O2 — CID 89068349
1,1,1,3,3,3-hexafluoro-2-(oxan-2-yl)propan-2-ol (PubChem CID 89068349) has the molecular formula C8H10F6O2 and a molecular weight of 252.15 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(oxan-2-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(oxan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 89068349 |
| Molecular Formula | C8H10F6O2 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(oxan-2-yl)propan-2-ol |
| SMILES | OC(C1CCCCO1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F6O2/c9-7(10,11)6(15,8(12,13)14)5-3-1-2-4-16-5/h5,15H,1-4H2 |
| InChIKey | IGLXGGGDUPUPAH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |