C6H8F2O3 — CID 99640388
2,2-difluoro-2-[(2S)-oxolan-2-yl]acetic acid (PubChem CID 99640388) has the molecular formula C6H8F2O3 and a molecular weight of 166.12 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2S)-oxolan-2-yl]acetic acid.
| Compound Name | 2,2-difluoro-2-[(2S)-oxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 99640388 |
| Molecular Formula | C6H8F2O3 |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 2,2-difluoro-2-[(2S)-oxolan-2-yl]acetic acid |
| SMILES | O=C(O)C(F)(F)[C@@H]1CCCO1 |
| InChI | InChI=1S/C6H8F2O3/c7-6(8,5(9)10)4-2-1-3-11-4/h4H,1-3H2,(H,9,10)/t4-/m0/s1 |
| InChIKey | XNHRBXIYSXVOGJ-BYPYZUCNSA-N |
| XLogP | 0.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |