About alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid
alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid (PubChem CID 173211036) has the molecular formula C10H21AlO5
and a molecular weight of 248.25 g/mol. Its IUPAC name is alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid.
Molecular Properties
| Compound Name | alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid |
| PubChem CID | 173211036 |
| Molecular Formula | C10H21AlO5 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid |
| SMILES | CCOC(OC)(C(=O)O)C1CCCCO1.[AlH3] |
| InChI | InChI=1S/C10H18O5.Al.3H/c1-3-15-10(13-2,9(11)12)8-6-4-5-7-14-8;;;;/h8H,3-7H2,1-2H3,(H,11,12);;;; |
| InChIKey | HGIZCCFKUUCJBV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid?
The IUPAC name of alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid (CID 173211036) is alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid.
What is the SMILES notation for alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid?
The canonical SMILES for alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid is CCOC(OC)(C(=O)O)C1CCCCO1.[AlH3].
What is the InChIKey of alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid?
The InChIKey is HGIZCCFKUUCJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5.Al.3H/c1-3-15-10(13-2,9(11)12)8-6-4-5-7-14-8;;;;/h8H,3-7H2,1-2H3,(H,11,12);;;;.
What are the key properties of alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid?
alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid has a molecular weight of 248.25 g/mol, XLogP of -0.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;2-ethoxy-2-methoxy-2-(oxan-2-yl)acetic acid is sourced from PubChem (CID 173211036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).