C10H17F3O5 — CID 156747447
methanediol;2-(oxolan-2-yl)propan-2-yl 2,2,2-trifluoroacetate (PubChem CID 156747447) has the molecular formula C10H17F3O5 and a molecular weight of 274.24 g/mol. Its IUPAC name is methanediol;2-(oxolan-2-yl)propan-2-yl 2,2,2-trifluoroacetate.
| Compound Name | methanediol;2-(oxolan-2-yl)propan-2-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156747447 |
| Molecular Formula | C10H17F3O5 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | methanediol;2-(oxolan-2-yl)propan-2-yl 2,2,2-trifluoroacetate |
| SMILES | CC(C)(OC(=O)C(F)(F)F)C1CCCO1.OCO |
| InChI | InChI=1S/C9H13F3O3.CH4O2/c1-8(2,6-4-3-5-14-6)15-7(13)9(10,11)12;2-1-3/h6H,3-5H2,1-2H3;2-3H,1H2 |
| InChIKey | WQVQHVZAKSQWPE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|